Difference between revisions of "Tiso gene 4740"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIETHYLPHOSPHATE DIETHYLPHOSPHATE] == * smiles: ** CCOP(=O)([O-])OCC * inchi key: ** InChIKey=U...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-3-GLUCOSIDE-CMPD PELARGONIDIN-3-GLUCOSIDE-CMPD] == * smiles: ** C(O)C1(C(O)C(O)C(O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-3-GLUCOSIDE-CMPD PELARGONIDIN-3-GLUCOSIDE-CMPD] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(=CC4(=C([O+]=C(C2(=CC=C(O)C=C2))3)C=C(C=C([O-])4)[O-]))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** pelargonidin-3-O-β-D-glucoside |
+ | * inchi key: | ||
+ | ** InChIKey=ABVCUBUIXWJYSE-GQUPQBGVSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 431.375 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** callistephin |
− | ** | + | ** 3-(β-D-glucopyranosyloxy)-55,7-dihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7828]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515300 102515300] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31967 31967] |
+ | * METABOLIGHTS : MTBLC31967 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12137 C12137] |
− | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(=CC4(=C([O+]=C(C2(=CC=C(O)C=C2))3)C=C(C=C([O-])4)[O-])))}} | |
− | {{#set: smiles= | + | {{#set: common name=pelargonidin-3-O-β-D-glucoside}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ABVCUBUIXWJYSE-GQUPQBGVSA-M}} |
− | {{#set: | + | {{#set: molecular weight=431.375 }} |
− | {{#set: molecular weight= | + | {{#set: common name=callistephin|3-(β-D-glucopyranosyloxy)-55,7-dihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-7828}} |
− | {{#set: | + |
Revision as of 15:43, 21 March 2018
Contents
Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC3(=CC4(=C([O+]=C(C2(=CC=C(O)C=C2))3)C=C(C=C([O-])4)[O-])))
- common name:
- pelargonidin-3-O-β-D-glucoside
- inchi key:
- InChIKey=ABVCUBUIXWJYSE-GQUPQBGVSA-M
- molecular weight:
- 431.375
- Synonym(s):
- callistephin
- 3-(β-D-glucopyranosyloxy)-55,7-dihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OC3(=CC4(=C([O+]=C(C2(=CC=C(O)C=C2))3)C=C(C=C([O-])4)[O-])))" cannot be used as a page name in this wiki.