Difference between revisions of "Tiso gene 4164"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-315 CPD-315] == * smiles: ** CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16629 RXN-16629] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-315 CPD-315] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16629 RXN-16629] ==
−
* smiles:
+
* direction:
−
** CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L
+
 
* common name:
 
* common name:
−
** cyanocob(III)alamin
+
** 3-oxoacyl-synthase
−
* molecular weight:
+
* ec number:
−
** 1355.377   
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** cyanocobalamin
 
−
** rubramin
 
−
** vitamin B12
 
−
** alphamine
 
−
** crystamine
 
−
** cyanoject
 
−
** cyomin
 
−
** cytamen
 
−
** hydrobexan
 
−
** rubesol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[TransportSeed_CPD-315]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Oleoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[11Z-3-oxo-icos-11-enoyl-ACPs]][c] '''+''' 1 [[ACP]][c]
−
* [[TransportSeed_CPD-315]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 an oleoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''=>''' 1 CO2[c] '''+''' 1 an (11Z)-3-oxo-icos-11-enoyl-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c]
−
* [[ExchangeSeed_CPD-315]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7663]], gondoate biosynthesis (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7663 PWY-7663]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 68-19-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* DRUGBANK : DB00115
+
{{#set: common name=3-oxoacyl-synthase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-2.3.1.41}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678590 70678590]
+
{{#set: gene associated=Tiso_gene_5939}}
−
* HMDB : HMDB00607
+
{{#set: in pathway=PWY-7663}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02823 C02823]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17439 17439]
+
−
{{#set: smiles=CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))}}
+
−
{{#set: inchi key=InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L}}
+
−
{{#set: common name=cyanocob(III)alamin}}
+
−
{{#set: molecular weight=1355.377    }}
+
−
{{#set: common name=cyanocobalamin|rubramin|vitamin B12|alphamine|crystamine|cyanoject|cyomin|cytamen|hydrobexan|rubesol}}
+
−
{{#set: consumed by=TransportSeed_CPD-315}}
+
−
{{#set: produced by=TransportSeed_CPD-315}}
+
−
{{#set: reversible reaction associated=ExchangeSeed_CPD-315}}
+

Revision as of 15:43, 21 March 2018

Reaction RXN-16629

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7663, gondoate biosynthesis (anaerobic): PWY-7663
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4164&oldid=35858"