Difference between revisions of "CPD-15666"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14275 CPD-14275] == * smiles: ** CCCCCCCCCCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == * smiles: ** COC1(C=C(C=CC=O)C=C(OC)C(O)=1) * common name: ** s...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == |
* smiles: | * smiles: | ||
− | ** | + | ** COC1(C=C(C=CC=O)C=C(OC)C(O)=1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** sinapaldehyde |
+ | * inchi key: | ||
+ | ** InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 208.213 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-1125]] |
+ | * [[RXN-8014]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-1143]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-1124]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280802 5280802] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4444359.html 4444359] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27949 27949] |
− | {{#set: smiles= | + | * METABOLIGHTS : MTBLC27949 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05610 C05610] |
− | {{#set: molecular weight= | + | {{#set: smiles=COC1(C=C(C=CC=O)C=C(OC)C(O)=1)}} |
− | {{#set: consumed by=RXN- | + | {{#set: common name=sinapaldehyde}} |
− | {{#set: produced by=RXN- | + | {{#set: inchi key=InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N}} |
+ | {{#set: molecular weight=208.213 }} | ||
+ | {{#set: consumed by=RXN-1125|RXN-8014}} | ||
+ | {{#set: produced by=RXN-1143}} | ||
+ | {{#set: reversible reaction associated=RXN-1124}} |
Revision as of 16:43, 21 March 2018
Contents
Metabolite SINAPALDEHYDE
- smiles:
- COC1(C=C(C=CC=O)C=C(OC)C(O)=1)
- common name:
- sinapaldehyde
- inchi key:
- InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N
- molecular weight:
- 208.213
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links