Difference between revisions of "Very-Long-Chain-oxoacyl-CoAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-361 RXN0-361] == * direction: ** LEFT-TO-RIGHT * common name: ** inosine-uridine_preferring_nu...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-361 RXN0-361] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
+
 
* common name:
 
* common name:
−
** 6-cis, 2-trans-tridecadienoyl-CoA
+
** inosine-uridine_preferring_nucleoside_hydrolase
−
* molecular weight:
+
* ec number:
−
** 955.803   
+
** [http://enzyme.expasy.org/EC/3.2.2.3 EC-3.2.2.3]
 
* Synonym(s):
 
* Synonym(s):
−
** 6Z, 2E-tridecadienoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14771]]
+
** 1 [[CYTIDINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[D-Ribofuranose]][c] '''+''' 1 [[CYTOSINE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 cytidine[c] '''+''' 1 H2O[c] '''=>''' 1 D-ribofuranose[c] '''+''' 1 cytosine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9396]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7195]], pyrimidine ribonucleosides salvage III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7195 PWY-7195]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658546 90658546]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27958 27958]
−
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R02137 R02137]
−
{{#set: common name=6-cis, 2-trans-tridecadienoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=955.803    }}
+
{{#set: common name=inosine-uridine_preferring_nucleoside_hydrolase}}
−
{{#set: common name=6Z, 2E-tridecadienoyl-CoA}}
+
{{#set: ec number=EC-3.2.2.3}}
−
{{#set: produced by=RXN-14771}}
+
{{#set: gene associated=Tiso_gene_9396}}
 +
{{#set: in pathway=PWY-7195}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 16:43, 21 March 2018

Reaction RXN0-361

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • inosine-uridine_preferring_nucleoside_hydrolase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7195, pyrimidine ribonucleosides salvage III: PWY-7195
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Very-Long-Chain-oxoacyl-CoAs&oldid=35883"