Difference between revisions of "325-BISPHOSPHATE-NUCLEOTIDASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...") |
(Created page with "Category:Gene == Gene Tiso_gene_15128 == * right end position: ** 1853 * transcription direction: ** POSITIVE * left end position: ** 14 * centisome position: ** 0.2683020...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15128 == |
− | * | + | * right end position: |
− | ** | + | ** 1853 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 14 |
− | * | + | * centisome position: |
− | ** | + | ** 0.26830205 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[R524-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | ** Source: [[annotation-experimental_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Reaction: [[RXN-12893]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[CYANCAT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1853}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=14}} | |
− | + | {{#set: centisome position=0.26830205 }} | |
− | + | {{#set: reaction associated=R524-RXN|RXN-12893}} | |
− | + | {{#set: pathway associated=CYANCAT-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:43, 21 March 2018
Gene Tiso_gene_15128
- right end position:
- 1853
- transcription direction:
- POSITIVE
- left end position:
- 14
- centisome position:
- 0.26830205
- Synonym(s):
Reactions associated
- Reaction: R524-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: annotation-in-silico_annotation
- Reaction: RXN-12893
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation