Difference between revisions of "RXN0-947"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12651 == * left end position: ** 556 * transcription direction: ** NEGATIVE * right end position: ** 6594 * centisome position: ** 8.175268...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * common name: |
| − | ** | + | ** 6-cis, 2-trans-tridecadienoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 955.803 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 6Z, 2E-tridecadienoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-14771]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658546 90658546] |
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: common name=6-cis, 2-trans-tridecadienoyl-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J}} |
| − | {{#set: | + | {{#set: molecular weight=955.803 }} |
| + | {{#set: common name=6Z, 2E-tridecadienoyl-CoA}} | ||
| + | {{#set: produced by=RXN-14771}} | ||
Revision as of 16:44, 21 March 2018
Contents
Metabolite CPD-15666
- smiles:
- CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 6-cis, 2-trans-tridecadienoyl-CoA
- inchi key:
- InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
- molecular weight:
- 955.803
- Synonym(s):
- 6Z, 2E-tridecadienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
