Difference between revisions of "Tiso gene 2021"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2121 == * Synonym(s): == Reactions associated == * UDPNACETYLMURAMATEDEHYDROG-RXN ** in-silico_annotation ***ec-number == Pathways ass...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == * smiles: ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * common name: | ||
+ | ** 7-methyl-3-oxooct-6-enoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J | ||
+ | * molecular weight: | ||
+ | ** 915.695 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 7-methyl-3-oxo-6-octenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-11917]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986200 50986200] |
+ | * HMDB : HMDB60421 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71410 71410] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16466 C16466] | ||
+ | {{#set: smiles=CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: common name=7-methyl-3-oxooct-6-enoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J}} | ||
+ | {{#set: molecular weight=915.695 }} | ||
+ | {{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-11917}} |
Revision as of 15:45, 21 March 2018
Contents
Metabolite CPD-12897
- smiles:
- CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 7-methyl-3-oxooct-6-enoyl-CoA
- inchi key:
- InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J
- molecular weight:
- 915.695
- Synonym(s):
- 7-methyl-3-oxo-6-octenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.