Difference between revisions of "CPD-6993"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15377 CPD-15377] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14384 RXN-14384] == * direction: ** LEFT-TO-RIGHT * common name: ** cysteine_mitochondrial ** c...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15377 CPD-15377] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14384 RXN-14384] ==
* smiles:
+
* direction:
** [CH](=O)C(O)C(O)C(O)CO
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N
+
 
* common name:
 
* common name:
** aldehydo-D-xylose
+
** cysteine_mitochondrial
* molecular weight:
+
** cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf
** 150.131   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
 
* Synonym(s):
 
* Synonym(s):
** linear D-xylose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[S-CD-Apo-SP-Complex]][c] '''=>''' 1 [[CD-S-SP-Complex]][c]
* [[RXN-14503]]
+
* With common name(s):
 +
** 1 an S-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex[c] '''=>''' 1 a [cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11478]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14710]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_4284]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7250]], [2Fe-2S] iron-sulfur cluster biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250]
 +
** '''10''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644160 644160]
+
{{#set: common name=cysteine_mitochondrial}}
* CHEBI:
+
{{#set: common name=cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15936 15936]
+
{{#set: ec number=EC-2.8.1.7}}
* METABOLIGHTS : MTBLC15936
+
{{#set: gene associated=Tiso_gene_11478|Tiso_gene_14710|Tiso_gene_4284}}
* HMDB : HMDB60254
+
{{#set: in pathway=PWY-7250}}
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VPENINKCSA-N}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
{{#set: common name=aldehydo-D-xylose}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: molecular weight=150.131    }}
+
{{#set: common name=linear D-xylose}}
+
{{#set: reversible reaction associated=RXN-14503}}
+

Revision as of 15:45, 21 March 2018

Reaction RXN-14384

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cysteine_mitochondrial
    • cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an S-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex[c] => 1 a [cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7250, [2Fe-2S] iron-sulfur cluster biosynthesis: PWY-7250
    • 10 reactions found over 10 reactions in the full pathway

Reconstruction information

External links