|
|
| Line 1: |
Line 1: |
| − | [[Category:Reaction]] | + | [[Category:Metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FARNESYLTRANSTRANSFERASE-RXN FARNESYLTRANSTRANSFERASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] == |
| − | * direction: | + | * smiles: |
| − | ** LEFT-TO-RIGHT | + | ** C([R])C(=O)CC(=O)[O-] |
| | * common name: | | * common name: |
| − | ** farnesyltranstransferase | + | ** a 3-oxo acid |
| − | ** geranylgeranyl_pyrophosphate_synthase
| + | |
| − | * ec number:
| + | |
| − | ** [http://enzyme.expasy.org/EC/2.5.1.29 EC-2.5.1.29]
| + | |
| | * Synonym(s): | | * Synonym(s): |
| | + | ** 3-oxy acid |
| | + | ** 3-oxygen acid |
| | | | |
| − | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
| − | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
| − | ** 1 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[FARNESYL-PP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[GERANYLGERANYL-PP]][c]
| + | == Reaction(s) of unknown directionality == |
| − | * With common name(s):
| + | * [[3-OXOACID-COA-TRANSFERASE-RXN]] |
| − | ** 1 isopentenyl diphosphate[c] '''+''' 1 (2E,6E)-farnesyl diphosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 geranylgeranyl diphosphate[c]
| + | |
| − | | + | |
| − | == Genes associated with this reaction == | + | |
| − | Genes have been associated with this reaction based on different elements listed below.
| + | |
| − | * [[Tiso_gene_16284]]
| + | |
| − | ** IN-SILICO_ANNOTATION
| + | |
| − | ***EC-NUMBER
| + | |
| − | ** EXPERIMENTAL_ANNOTATION
| + | |
| − | ***EC-NUMBER
| + | |
| − | ** [[pantograph]]-[[athaliana]]
| + | |
| − | ** [[pantograph]]-[[synechocystis]]
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_7305]]
| + | |
| − | ** IN-SILICO_ANNOTATION
| + | |
| − | ***AUTOMATED-NAME-MATCH
| + | |
| − | == Pathways == | + | |
| − | * [[PWY-7736]], stellatic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7736 PWY-7736]
| + | |
| − | ** '''3''' reactions found over '''8''' reactions in the full pathway
| + | |
| − | * [[PWY-7492]], paspaline biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7492 PWY-7492]
| + | |
| − | ** '''1''' reactions found over '''6''' reactions in the full pathway
| + | |
| − | * [[PWY-6659]], fusicoccin A biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6659 PWY-6659]
| + | |
| − | ** '''1''' reactions found over '''8''' reactions in the full pathway
| + | |
| − | * [[PWY-6691]], plaunotol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6691 PWY-6691]
| + | |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| + | |
| − | * [[PWY-5120]], geranylgeranyl diphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5120 PWY-5120]
| + | |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
| − | * [[PWY-7517]], brassicicene C biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7517 PWY-7517]
| + | |
| − | ** '''1''' reactions found over '''7''' reactions in the full pathway
| + | |
| − | * [[PWY-7721]], methyl phomopsenoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7721 PWY-7721]
| + | |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
| − | * [[PWY-7720]], ophiobolin F biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7720 PWY-7720] | + | |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| + | |
| − | == Reconstruction information ==
| + | |
| − | * Category: [[orthology]]
| + | |
| − | ** Source: [[orthology-athaliana]]
| + | |
| − | *** Tool: [[pantograph]]
| + | |
| − | ** Source: [[orthology-synechocystis]]
| + | |
| − | *** Tool: [[pantograph]]
| + | |
| − | ** Source: [[orthology-esiliculosus]]
| + | |
| − | *** Tool: [[pantograph]]
| + | |
| − | * Category: [[manual]]
| + | |
| − | ** Source: [[manual-primary_network]]
| + | |
| − | * Category: [[annotation]]
| + | |
| − | ** Source: [[annotation-in-silico_annotation]]
| + | |
| − | *** Tool: [[pathwaytools]]
| + | |
| − | ** Source: [[annotation-experimental_annotation]]
| + | |
| − | *** Tool: [[pathwaytools]]
| + | |
| | == External links == | | == External links == |
| − | * RHEA:
| + | * LIGAND-CPD: |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17653 17653]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01656 C01656] |
| − | * LIGAND-RXN: | + | * CHEBI: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02061 R02061] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47881 47881] |
| − | * UNIPROT: | + | {{#set: smiles=C([R])C(=O)CC(=O)[O-]}} |
| − | ** [http://www.uniprot.org/uniprot/P39464 P39464] | + | {{#set: common name=a 3-oxo acid}} |
| − | ** [http://www.uniprot.org/uniprot/P24322 P24322]
| + | {{#set: common name=3-oxy acid|3-oxygen acid}} |
| − | ** [http://www.uniprot.org/uniprot/P80042 P80042]
| + | {{#set: reversible reaction associated=3-OXOACID-COA-TRANSFERASE-RXN}} |
| − | ** [http://www.uniprot.org/uniprot/Q12051 Q12051]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P95999 P95999]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P48368 P48368]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P93227 P93227]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P93228 P93228]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q42698 Q42698]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q43133 Q43133]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q42866 Q42866]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P54976 P54976]
| + | |
| − | {{#set: direction=LEFT-TO-RIGHT}} | + | |
| − | {{#set: common name=farnesyltranstransferase}} | + | |
| − | {{#set: common name=geranylgeranyl_pyrophosphate_synthase}} | + | |
| − | {{#set: ec number=EC-2.5.1.29}}
| + | |
| − | {{#set: gene associated=Tiso_gene_16284|Tiso_gene_7305}}
| + | |
| − | {{#set: in pathway=PWY-7736|PWY-7492|PWY-6659|PWY-6691|PWY-5120|PWY-7517|PWY-7721|PWY-7720}}
| + | |
| − | {{#set: reconstruction category=orthology|manual|annotation}} | + | |
| − | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network}}
| + | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |
