Difference between revisions of "RXN1G-363"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2810 == * left end position: ** 2702 * transcription direction: ** NEGATIVE * right end position: ** 5264 * centisome position: ** 14.69356...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == |
− | * | + | * smiles: |
− | ** | + | ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))) |
− | * | + | * common name: |
− | ** | + | ** ent-kaur-16-en-19-oate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 301.448 |
* Synonym(s): | * Synonym(s): | ||
+ | ** ent-kaurenoate | ||
+ | ** ent-kaurenoic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[1. | + | * [[1.14.13.79-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-7580]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMPR0104130004 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200785 25200785] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57297 57297] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11874 C11874] | ||
+ | {{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))}} | ||
+ | {{#set: common name=ent-kaur-16-en-19-oate}} | ||
+ | {{#set: inchi key=InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M}} | ||
+ | {{#set: molecular weight=301.448 }} | ||
+ | {{#set: common name=ent-kaurenoate|ent-kaurenoic acid}} | ||
+ | {{#set: consumed by=1.14.13.79-RXN}} | ||
+ | {{#set: produced by=RXN-7580}} |
Revision as of 16:46, 21 March 2018
Contents
Metabolite CPD1F-132
- smiles:
- C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
- common name:
- ent-kaur-16-en-19-oate
- inchi key:
- InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
- molecular weight:
- 301.448
- Synonym(s):
- ent-kaurenoate
- ent-kaurenoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.