Difference between revisions of "RXN-11374"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] == * smiles: ** C(#N)CCC1(C=CC=CC=1) * inchi key: ** InChIKey=ACRWYXSKEHUQ...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mitochondrial-intermediate-protein mitochondrial-intermediate-protein] == * common name: ** mit...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mitochondrial-intermediate-protein mitochondrial-intermediate-protein] ==
* smiles:
+
** C(#N)CCC1(C=CC=CC=1)
+
* inchi key:
+
** InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 3-phenylpropionitrile
+
** mitochondrial intermediate protein
* molecular weight:
+
** 131.177   
+
 
* Synonym(s):
 
* Synonym(s):
** benzenepropanenitrile
 
** 2-phenylethyl cyanide
 
** 3-phenylpropanonitril
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18229]]
+
* [[3.4.24.59-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=mitochondrial intermediate protein}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12581 12581]
+
{{#set: consumed by=3.4.24.59-RXN}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.12061.html 12061]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85426 85426]
+
* HMDB : HMDB34236
+
{{#set: smiles=C(#N)CCC1(C=CC=CC=1)}}
+
{{#set: inchi key=InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N}}
+
{{#set: common name=3-phenylpropionitrile}}
+
{{#set: molecular weight=131.177    }}
+
{{#set: common name=benzenepropanenitrile|2-phenylethyl cyanide|3-phenylpropanonitril}}
+
{{#set: consumed by=RXN-18229}}
+

Revision as of 16:46, 21 March 2018

Metabolite mitochondrial-intermediate-protein

  • common name:
    • mitochondrial intermediate protein
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links