Difference between revisions of "COUMARATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARATE COUMARATE] == * smiles: ** C(=O)([O-])C=CC1(=CC=C(O)C=C1) * inchi key: ** InChIKey=NG...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEINE-AMINOTRANSFERASE-RXN CYSTEINE-AMINOTRANSFERASE-RXN] == * direction: ** REVERSIBLE * common...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEINE-AMINOTRANSFERASE-RXN CYSTEINE-AMINOTRANSFERASE-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** cysteine transaminase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.6.1.3 EC-2.6.1.3] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CYS]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[3-MERCAPTO-PYRUVATE]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 L-cysteine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 L-glutamate[c] '''+''' 1 3-mercaptopyruvate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_6815]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_17718]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5329]], L-cysteine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5329 PWY-5329] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY0-1534]], hydrogen sulfide biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1534 PWY0-1534] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17441 17441] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00895 R00895] | |
− | * LIGAND- | + | {{#set: direction=REVERSIBLE}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=cysteine transaminase}} |
− | + | {{#set: ec number=EC-2.6.1.3}} | |
− | + | {{#set: gene associated=Tiso_gene_6815|Tiso_gene_17718}} | |
− | + | {{#set: in pathway=PWY-5329|PWY0-1534}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii|orthology-athaliana|annotation-experimental_annotation}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:47, 21 March 2018
Contents
Reaction CYSTEINE-AMINOTRANSFERASE-RXN
- direction:
- REVERSIBLE
- common name:
- cysteine transaminase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CYS[c] + 1 2-KETOGLUTARATE[c] <=> 1 GLT[c] + 1 3-MERCAPTO-PYRUVATE[c]
- With common name(s):
- 1 L-cysteine[c] + 1 2-oxoglutarate[c] <=> 1 L-glutamate[c] + 1 3-mercaptopyruvate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6815
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-creinhardtii
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_17718
- Source: orthology-athaliana
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
Pathways
- PWY-5329, L-cysteine degradation III: PWY-5329
- 2 reactions found over 2 reactions in the full pathway
- PWY0-1534, hydrogen sulfide biosynthesis I: PWY0-1534
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links