Difference between revisions of "CPD-13910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14264 RXN-14264] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14264 RXN-14264] ==
−
* smiles:
+
* direction:
−
** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M
+
** [http://enzyme.expasy.org/EC/1.3.8.4 EC-1.3.8.4]
−
* common name:
+
−
** cyclic- 3,4-O-oxalyl-L-threonate
+
−
* molecular weight:
+
−
** 189.101   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-cyclic oxalyl theronolactone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12872]]
+
** 1 [[ISOVALERYL-COA]][c] '''+''' 1 [[FAD]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[3-METHYL-CROTONYL-COA]][c] '''+''' 1 [[FADH2]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 isovaleryl-CoA[c] '''+''' 1 FAD[c] '''+''' 1 H+[c] '''<=>''' 1 3-methylcrotonyl-CoA[c] '''+''' 1 FADH2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_8272]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14511]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18542]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_6475]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_10643]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658084 90658084]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31064 31064]
−
{{#set: smiles=C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1)}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=FTDFTFXOJYXVTH-UHFFFAOYSA-M}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R04095 R04095]
−
{{#set: common name=cyclic- 3,4-O-oxalyl-L-threonate}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: molecular weight=189.101    }}
+
{{#set: ec number=EC-1.3.8.4}}
−
{{#set: common name=3,4-cyclic oxalyl theronolactone}}
+
{{#set: gene associated=Tiso_gene_8272|Tiso_gene_14511|Tiso_gene_18542|Tiso_gene_6475|Tiso_gene_10643}}
−
{{#set: produced by=RXN-12872}}
+
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 16:47, 21 March 2018

Reaction RXN-14264

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13910&oldid=36319"