Difference between revisions of "Tiso gene 13303"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2353 CPD0-2353] == * common name: ** a tRNA precursor with a short 3' extension * Synonym(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])O * common name: ** 3-ethylmalate...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2353 CPD0-2353] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1130 CPD-1130] ==
 +
* smiles:
 +
** CCC(C([O-])=O)C(C(=O)[O-])O
 
* common name:
 
* common name:
** a tRNA precursor with a short 3' extension
+
** 3-ethylmalate
 +
* inchi key:
 +
** InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 160.126   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14986]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.26.5-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-18210]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a tRNA precursor with a short 3' extension}}
+
* PUBCHEM:
{{#set: produced by=3.1.26.5-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145023 21145023]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.20015785.html 20015785]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57425 57425]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01989 C01989]
 +
{{#set: smiles=CCC(C([O-])=O)C(C(=O)[O-])O}}
 +
{{#set: common name=3-ethylmalate}}
 +
{{#set: inchi key=InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L}}
 +
{{#set: molecular weight=160.126    }}
 +
{{#set: consumed by=RXN-14986}}
 +
{{#set: reversible reaction associated=RXN-18210}}

Revision as of 15:48, 21 March 2018

Metabolite CPD-1130

  • smiles:
    • CCC(C([O-])=O)C(C(=O)[O-])O
  • common name:
    • 3-ethylmalate
  • inchi key:
    • InChIKey=JUCRENBZZQKFGK-UHFFFAOYSA-L
  • molecular weight:
    • 160.126
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(C([O-])=O)C(C(=O)[O-])O" cannot be used as a page name in this wiki.