Difference between revisions of "Tiso gene 12953"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7201 == * left end position: ** 191 * transcription direction: ** POSITIVE * right end position: ** 6869 * centisome position: ** 1.6758796...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) * common name: *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == |
− | * | + | * smiles: |
− | ** | + | ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) |
− | * | + | * common name: |
− | ** | + | ** indole-3-glycol |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 177.202 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-5424]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202910 25202910] |
− | {{#set: | + | {{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(O)CO)}} |
− | {{#set: | + | {{#set: common name=indole-3-glycol}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N}} |
− | + | {{#set: molecular weight=177.202 }} | |
+ | {{#set: produced by=RXN-5424}} |
Revision as of 16:48, 21 March 2018
Contents
Metabolite INDOLE-3-GLYCOL
- smiles:
- C2(=C(C1(C=CC=CC=1N2))C(O)CO)
- common name:
- indole-3-glycol
- inchi key:
- InChIKey=XNJDZRGYWQBBMZ-UHFFFAOYSA-N
- molecular weight:
- 177.202
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: