Difference between revisions of "Cis-delta13-3-oxo-lacceroyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5187 RXN0-5187] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5187 RXN0-5187] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/3.1.3.102 EC-3.1.3.102]
+
** 2-trans-6-trans-tridecadienoyl-CoA
 +
* inchi key:
 +
** InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J
 +
* molecular weight:
 +
** 955.803   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2E, 6E-tridecadienoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[FMN]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[RIBOFLAVIN]][c]
+
* [[RXN-14785]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 FMN[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 riboflavin[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_17529]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00548 R00548]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658431 90658431]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: ec number=EC-3.1.3.102}}
+
{{#set: common name=2-trans-6-trans-tridecadienoyl-CoA}}
−
{{#set: gene associated=Tiso_gene_17529}}
+
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=955.803    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=2E, 6E-tridecadienoyl-CoA}}
−
{{#set: reconstruction source=orthology-athaliana}}
+
{{#set: produced by=RXN-14785}}
−
{{#set: reconstruction tool=pantograph}}
+

Revision as of 16:48, 21 March 2018

Metabolite CPD-15675

  • smiles:
    • CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 2-trans-6-trans-tridecadienoyl-CoA
  • inchi key:
    • InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J
  • molecular weight:
    • 955.803
  • Synonym(s):
    • 2E, 6E-tridecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-delta13-3-oxo-lacceroyl-ACPs&oldid=36455"