Difference between revisions of "Tiso gene 3487"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * smiles: ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Polyphosphate Long-Chain-Polyphosphate] == * common name: ** long chain polyphosphat...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Polyphosphate Long-Chain-Polyphosphate] ==
* smiles:
+
** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
+
 
* common name:
 
* common name:
** (7Z)-tetradecenoyl-CoA
+
** long chain polyphosphate
* molecular weight:
+
** 971.845   
+
 
* Synonym(s):
 
* Synonym(s):
** 14:1-Δ7-CoA
+
** (phosphate)(n)
** cis-7-tetradecenoyl-CoA
+
** (phosphate)(n+1)
** 14:1(n-7)-CoA
+
** (phosphate)(n-1)
** (7Z)-tetradec-7-enoyl-CoA
+
** (polyphosphate)(n)
 +
** (polyphosphate)(n+1)
 +
** (polyphosphate)(n-1)
 +
** PolyP
 +
** inorganic polyphosphate
 +
** (polyphosphate)(n-2)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17792]]
+
* [[EXOPOLYPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17791]]
+
* [[EXOPOLYPHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=long chain polyphosphate}}
{{#set: inchi key=InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J}}
+
{{#set: common name=(phosphate)(n)|(phosphate)(n+1)|(phosphate)(n-1)|(polyphosphate)(n)|(polyphosphate)(n+1)|(polyphosphate)(n-1)|PolyP|inorganic polyphosphate|(polyphosphate)(n-2)}}
{{#set: common name=(7Z)-tetradecenoyl-CoA}}
+
{{#set: consumed by=EXOPOLYPHOSPHATASE-RXN}}
{{#set: molecular weight=971.845    }}
+
{{#set: produced by=EXOPOLYPHOSPHATASE-RXN}}
{{#set: common name=14:1-Δ7-CoA|cis-7-tetradecenoyl-CoA|14:1(n-7)-CoA|(7Z)-tetradec-7-enoyl-CoA}}
+
{{#set: consumed by=RXN-17792}}
+
{{#set: produced by=RXN-17791}}
+

Revision as of 16:49, 21 March 2018

Metabolite Long-Chain-Polyphosphate

  • common name:
    • long chain polyphosphate
  • Synonym(s):
    • (phosphate)(n)
    • (phosphate)(n+1)
    • (phosphate)(n-1)
    • (polyphosphate)(n)
    • (polyphosphate)(n+1)
    • (polyphosphate)(n-1)
    • PolyP
    • inorganic polyphosphate
    • (polyphosphate)(n-2)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links