Difference between revisions of "Histone-L-lysine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17735 RXN-17735] == * direction: ** LEFT-TO-RIGHT * common name: ** abhydrolase_domain-containi...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17735 RXN-17735] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
+
 
* common name:
 
* common name:
−
** (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
+
** abhydrolase_domain-containing_protein_4-like
−
* molecular weight:
+
** ORF
−
** 519.151   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
 
* Synonym(s):
 
* Synonym(s):
−
** 3',8-cH2GTP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-8340]]
+
** 1 [[WATER]][c] '''+''' 1 [[Alkyl-enyl-acyl-gly-P-EtOH-amines]][c] '''=>''' 1 [[Long-Chain-Fatty-Acids]][c] '''+''' 1 [[1-Alkenylglycerophosphoethanolamines]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 a plasmenylethanolamine[c] '''=>''' 1 a long-chain fatty acid[c] '''+''' 1 a 1-O-(alk-1-enyl)-sn-glycero-3-phosphoethanolamine[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12959]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_12960]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15046]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15047]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7783]], plasmalogen degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7783 PWY-7783]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J}}
+
{{#set: common name=abhydrolase_domain-containing_protein_4-like}}
−
{{#set: common name=(8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}}
+
{{#set: common name=ORF}}
−
{{#set: molecular weight=519.151    }}
+
{{#set: ec number=EC-3.1.1.4}}
−
{{#set: common name=3',8-cH2GTP}}
+
{{#set: gene associated=Tiso_gene_12959|Tiso_gene_12960|Tiso_gene_15046|Tiso_gene_15047}}
−
{{#set: produced by=RXN-8340}}
+
{{#set: in pathway=PWY-7783}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 15:49, 21 March 2018

Reaction RXN-17735

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • abhydrolase_domain-containing_protein_4-like
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7783, plasmalogen degradation: PWY-7783
    • 2 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Histone-L-lysine&oldid=36574"