Difference between revisions of "RXN-15124"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquitins Ubiquitins] == * common name: ** a ubiquitin * Synonym(s): == Reaction(s) known to...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == |
| + | * smiles: | ||
| + | ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) | ||
* common name: | * common name: | ||
| − | ** | + | ** reduced riboflavin |
| + | * inchi key: | ||
| + | ** InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N | ||
| + | * molecular weight: | ||
| + | ** 378.384 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4a,5-dihydroriboflavine | ||
| + | ** 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine | ||
| + | ** 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12445]] |
| + | * [[NADPH-DEHYDROGENASE-FLAVIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480537 45480537] |
| + | * HMDB : HMDB01557 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01007 C01007] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.52885.html 52885] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8798 8798] | ||
| + | * BIGG : rbflvrd | ||
| + | {{#set: smiles=CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)}} | ||
| + | {{#set: common name=reduced riboflavin}} | ||
| + | {{#set: inchi key=InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N}} | ||
| + | {{#set: molecular weight=378.384 }} | ||
| + | {{#set: common name=4a,5-dihydroriboflavine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione}} | ||
| + | {{#set: produced by=RXN-12445|NADPH-DEHYDROGENASE-FLAVIN-RXN}} | ||
Revision as of 15:49, 21 March 2018
Contents
Metabolite CPD-316
- smiles:
- CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)
- common name:
- reduced riboflavin
- inchi key:
- InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N
- molecular weight:
- 378.384
- Synonym(s):
- 4a,5-dihydroriboflavine
- 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine
- 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione" cannot be used as a page name in this wiki.
