Difference between revisions of "RXN0-308"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * smiles: ** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_6680 == * right end position: ** 3307 * transcription direction: ** POSITIVE * left end position: ** 1527 * centisome position: ** 6.608959...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6680 == |
− | * | + | * right end position: |
− | ** | + | ** 3307 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1527 |
− | * | + | * centisome position: |
− | ** | + | ** 6.608959 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[GLUTATHIONE-PEROXIDASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-synechocystis]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[GTHP]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[DETOX1-PWY-1]] | ||
+ | * [[PWY-4081]] | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: right end position=3307}} |
− | {{#set: | + | {{#set: transcription direction=POSITIVE}} |
− | {{#set: | + | {{#set: left end position=1527}} |
− | {{#set: | + | {{#set: centisome position=6.608959 }} |
− | {{#set: | + | {{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN|GTHP}} |
− | {{#set: | + | {{#set: pathway associated=DETOX1-PWY-1|PWY-4081}} |
Revision as of 16:50, 21 March 2018
Gene Tiso_gene_6680
- right end position:
- 3307
- transcription direction:
- POSITIVE
- left end position:
- 1527
- centisome position:
- 6.608959
- Synonym(s):
Reactions associated
- Reaction: GLUTATHIONE-PEROXIDASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: GTHP
- Source: orthology-creinhardtii