Difference between revisions of "INORGPYROPHOSPHAT-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R04560 R04560] == * direction: ** LEFT-TO-RIGHT * common name: ** R543 * Synonym(s): == Reaction F...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R04560 R04560] ==
* smiles:
+
* direction:
** COC1(=CC(=CCCO)C=CC(=O)1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** coniferyl alcohol radical
+
** R543
* molecular weight:
+
** 179.195   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-17352]]
+
** 1.0 [[AICAR]][c] '''+''' 1.0 [[10-FORMYL-THF]][c] '''=>''' 1.0 [[PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE]][c] '''+''' 1.0 [[THF]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide[c] '''+''' 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] '''=>''' 1.0 5-formamido-1-(5-phospho-D-ribosyl)-imidazole-4-carboxamide[c] '''+''' 1.0 tetrahydropteroyl mono-L-glutamate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18420]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}}
+
{{#set: common name=R543}}
{{#set: common name=coniferyl alcohol radical}}
+
{{#set: gene associated=Tiso_gene_18420}}
{{#set: molecular weight=179.195    }}
+
{{#set: in pathway=}}
{{#set: produced by=RXN-17352}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-synechocystis}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 15:50, 21 March 2018

Reaction R04560

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • R543
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide[c] + 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] => 1.0 5-formamido-1-(5-phospho-D-ribosyl)-imidazole-4-carboxamide[c] + 1.0 tetrahydropteroyl mono-L-glutamate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links