Difference between revisions of "ExchangeSeed ZN+2"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12257 == * Synonym(s): == Reactions associated == * ADENYL-KIN-RXN ** pantograph-athaliana ** pantograph-creinhardtii...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * common name: ** 3-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == |
| + | * smiles: | ||
| + | ** C(OP([O-])([O-])=O)C([N+])C([O-])=O | ||
| + | * common name: | ||
| + | ** 3-phospho-L-serine | ||
| + | * inchi key: | ||
| + | ** InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L | ||
| + | * molecular weight: | ||
| + | ** 183.057 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** O-phospho-L-serine | ||
| + | ** L-serine phosphate | ||
| + | ** phosphoryl-L-serine | ||
| + | ** L-seryl phosphate | ||
| + | ** L-serine-3P | ||
| + | ** L-serine 3-phosphate | ||
| + | ** 3-phospho-L-serine | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-5114]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[PSERTRANSAM-RXN]] | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 407-41-0 |
| − | {{#set: | + | * CAS : 17885-08-4 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059387 7059387] | ||
| + | * HMDB : HMDB00272 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01005 C01005] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5415612.html 5415612] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57524 57524] | ||
| + | * BIGG : pser__L | ||
| + | {{#set: smiles=C(OP([O-])([O-])=O)C([N+])C([O-])=O}} | ||
| + | {{#set: common name=3-phospho-L-serine}} | ||
| + | {{#set: inchi key=InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L}} | ||
| + | {{#set: molecular weight=183.057 }} | ||
| + | {{#set: common name=O-phospho-L-serine|L-serine phosphate|phosphoryl-L-serine|L-seryl phosphate|L-serine-3P|L-serine 3-phosphate|3-phospho-L-serine}} | ||
| + | {{#set: consumed by=RXN0-5114}} | ||
| + | {{#set: reversible reaction associated=PSERTRANSAM-RXN}} | ||
Revision as of 15:51, 21 March 2018
Contents
Metabolite 3-P-SERINE
- smiles:
- C(OP([O-])([O-])=O)C([N+])C([O-])=O
- common name:
- 3-phospho-L-serine
- inchi key:
- InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L
- molecular weight:
- 183.057
- Synonym(s):
- O-phospho-L-serine
- L-serine phosphate
- phosphoryl-L-serine
- L-seryl phosphate
- L-serine-3P
- L-serine 3-phosphate
- 3-phospho-L-serine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 407-41-0
- CAS : 17885-08-4
- PUBCHEM:
- HMDB : HMDB00272
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : pser__L
"C(OP([O-])([O-])=O)C([N+])C([O-])=O" cannot be used as a page name in this wiki.
