Difference between revisions of "L-BETA-ASPARTYL-P"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-305 RXN0-305] == * direction: ** REVERSIBLE * common name: ** hydroxypyruvate_isomerase * ec n...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * common name: ** 3-ethyl-2-o...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC(C([O-])=O)C(C(=O)[O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** 3-ethyl-2-oxosuccinate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L |
| + | * molecular weight: | ||
| + | ** 158.11 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-18211]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-18210]] | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | * | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: smiles=CCC(C([O-])=O)C(C(=O)[O-])=O}} | |
| − | + | {{#set: common name=3-ethyl-2-oxosuccinate}} | |
| − | + | {{#set: inchi key=InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L}} | |
| − | + | {{#set: molecular weight=158.11 }} | |
| − | + | {{#set: consumed by=RXN-18211}} | |
| − | {{#set: common name= | + | {{#set: reversible reaction associated=RXN-18210}} |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:51, 21 March 2018
Contents
Metabolite CPD-19492
- smiles:
- CCC(C([O-])=O)C(C(=O)[O-])=O
- common name:
- 3-ethyl-2-oxosuccinate
- inchi key:
- InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L
- molecular weight:
- 158.11
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C([O-])=O)C(C(=O)[O-])=O" cannot be used as a page name in this wiki.
