Difference between revisions of "Tiso gene 6340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta19-3-oxo-C38-ACPs cis-delta19-3-oxo-C38-ACPs] == * common name: ** a cis-delta19-3-oxo...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta19-3-oxo-C38-ACPs cis-delta19-3-oxo-C38-ACPs] ==
* smiles:
+
** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
+
* inchi key:
+
** InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
+
 
* common name:
 
* common name:
** D-nopaline
+
** a cis-delta19-3-oxo-C38:1-[acp]
* molecular weight:
+
** 303.294   
+
 
* Synonym(s):
 
* Synonym(s):
** N2-(D-1,3-dicarboxypropyl)-L-arginine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-1053]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.5.1.19-RXN]]
+
* [[RXN1G-1003]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis-delta19-3-oxo-C38:1-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791983 49791983]
+
{{#set: consumed by=RXN1G-1053}}
* CHEBI:
+
{{#set: produced by=RXN1G-1003}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682]
+
{{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}}
+
{{#set: inchi key=InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M}}
+
{{#set: common name=D-nopaline}}
+
{{#set: molecular weight=303.294    }}
+
{{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}}
+
{{#set: produced by=1.5.1.19-RXN}}
+

Revision as of 15:52, 21 March 2018

Metabolite cis-delta19-3-oxo-C38-ACPs

  • common name:
    • a cis-delta19-3-oxo-C38:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta19-3-oxo-C38:1-[acp" cannot be used as a page name in this wiki.