Difference between revisions of "Tiso gene 10542"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * smiles: ** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4222 RXN0-4222] == * direction: ** LEFT-TO-RIGHT * common name: ** exosome_complex_exonuclease...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4222 RXN0-4222] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** exosome_complex_exonuclease |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.13.1 EC-3.1.13.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD0-2351]][c] '''=>''' 1 [[Ribonucleoside-Monophosphates]][c] '''+''' 1 [[CPD0-2354]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 a tRNA precursor with a 5' extension and a long 3' trailer[c] '''=>''' 1 a ribonucleoside 5'-monophosphate[c] '''+''' 1 a tRNA precursor with a 5' extension[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_11613]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_11612]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY0-1479]], tRNA processing: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1479 PWY0-1479] | ||
+ | ** '''4''' reactions found over '''10''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=exosome_complex_exonuclease}} | |
− | + | {{#set: ec number=EC-3.1.13.1}} | |
− | + | {{#set: gene associated=Tiso_gene_11613|Tiso_gene_11612}} | |
− | + | {{#set: in pathway=PWY0-1479}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:53, 21 March 2018
Contents
Reaction RXN0-4222
- direction:
- LEFT-TO-RIGHT
- common name:
- exosome_complex_exonuclease
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD0-2351[c] => 1 Ribonucleoside-Monophosphates[c] + 1 CPD0-2354[c]
- With common name(s):
- 1 H2O[c] + 1 a tRNA precursor with a 5' extension and a long 3' trailer[c] => 1 a ribonucleoside 5'-monophosphate[c] + 1 a tRNA precursor with a 5' extension[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11613
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_11612
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation