Difference between revisions of "Tiso gene 7123"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14220 == * left end position: ** 146 * transcription direction: ** POSITIVE * right end position: ** 5704 * centisome position: ** 2.530329...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14426 CPD-14426] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14426 CPD-14426] == |
− | * | + | * smiles: |
− | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * common name: |
− | ** | + | ** docosapentaenoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NDRVWKXEWNMEEO-HVGANWHPSA-J |
− | * | + | * molecular weight: |
− | ** | + | ** 1075.997 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl-CoA | ||
+ | ** (7Z,10Z,13Z,16Z,19Z)-docosapentaenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-13446]] |
− | + | * [[RXN-16082]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-13445]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581114 71581114] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73870 73870] |
− | {{#set: | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: common name=docosapentaenoyl-CoA}} |
+ | {{#set: inchi key=InChIKey=NDRVWKXEWNMEEO-HVGANWHPSA-J}} | ||
+ | {{#set: molecular weight=1075.997 }} | ||
+ | {{#set: common name=(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl-CoA|(7Z,10Z,13Z,16Z,19Z)-docosapentaenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-13446|RXN-16082}} | ||
+ | {{#set: produced by=RXN-13445}} |
Revision as of 16:53, 21 March 2018
Contents
Metabolite CPD-14426
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- docosapentaenoyl-CoA
- inchi key:
- InChIKey=NDRVWKXEWNMEEO-HVGANWHPSA-J
- molecular weight:
- 1075.997
- Synonym(s):
- (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl-CoA
- (7Z,10Z,13Z,16Z,19Z)-docosapentaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.