Difference between revisions of "3-DEHYDROQUINATE-DEHYDRATASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: *...")
(Created page with "Category:Gene == Gene Tiso_gene_18652 == * right end position: ** 2678 * transcription direction: ** POSITIVE * left end position: ** 51 * centisome position: ** 1.7665397...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] ==
+
== Gene Tiso_gene_18652 ==
* smiles:
+
* right end position:
** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
+
** 2678
* inchi key:
+
* transcription direction:
** InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L
+
** POSITIVE
* common name:
+
* left end position:
** α-D-mannose 1-phosphate
+
** 51
* molecular weight:
+
* centisome position:
** 258.121    
+
** 1.7665397    
 
* Synonym(s):
 
* Synonym(s):
** mannose-1-phosphate
 
** D-mannose-1-phosphate
 
** mannose-1-P
 
** α-D-mannopyranose 1-phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[2.7.7.13-RXN]]
+
* Reaction: [[GLYOHMETRANS-RXN]]
* [[GAMPG]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
* [[MANNPGUANYLTRANGDP-RXN]]
+
* Reaction: [[RXN0-5234]]
* [[PHOSMANMUT-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-2161]]
 +
* [[PWY-1622]]
 +
* [[PWY-3841]]
 +
* [[1CMET2-PWY]]
 +
* [[PWY-3661]]
 +
* [[GLYSYN-PWY]]
 +
* [[PWY-5497]]
 +
* [[PWY-2201]]
 +
* [[PWY-181]]
 +
* [[PWY-3661-1]]
 
== External links  ==
 
== External links  ==
* CAS : 27251-84-9
+
{{#set: right end position=2678}}
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245607 25245607]
+
{{#set: left end position=51}}
* HMDB : HMDB06330
+
{{#set: centisome position=1.7665397   }}
* LIGAND-CPD:
+
{{#set: reaction associated=GLYOHMETRANS-RXN|RXN0-5234}}
** [http://www.genome.jp/dbget-bin/www_bget?C00636 C00636]
+
{{#set: pathway associated=PWY-2161|PWY-1622|PWY-3841|1CMET2-PWY|PWY-3661|GLYSYN-PWY|PWY-5497|PWY-2201|PWY-181|PWY-3661-1}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58409 58409]
+
* BIGG : man1p
+
{{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}}
+
{{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L}}
+
{{#set: common name=α-D-mannose 1-phosphate}}
+
{{#set: molecular weight=258.121   }}
+
{{#set: common name=mannose-1-phosphate|D-mannose-1-phosphate|mannose-1-P|α-D-mannopyranose 1-phosphate}}
+
{{#set: consumed by=2.7.7.13-RXN|GAMPG}}
+
{{#set: reversible reaction associated=MANNPGUANYLTRANGDP-RXN|PHOSMANMUT-RXN}}
+

Revision as of 16:53, 21 March 2018

Gene Tiso_gene_18652

  • right end position:
    • 2678
  • transcription direction:
    • POSITIVE
  • left end position:
    • 51
  • centisome position:
    • 1.7665397
  • Synonym(s):

Reactions associated

Pathways associated

External links