Difference between revisions of "PRTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8529 CPD-8529] == * smiles: ** C(SSC([R2])[R1])([R4])[R3] * common name: ** R'C(R)S-S(R)CR'...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-PROLINE D-PROLINE] == * smiles: ** C1([N+]C(CC1)C(=O)[O-]) * common name: ** D-proline * inch...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-PROLINE D-PROLINE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1([N+]C(CC1)C(=O)[O-]) |
* common name: | * common name: | ||
− | ** | + | ** D-proline |
+ | * inchi key: | ||
+ | ** InChIKey=ONIBWKKTOPOVIA-SCSAIBSYSA-N | ||
+ | * molecular weight: | ||
+ | ** 115.132 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[PROLINE-RACEMASE-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: smiles= | + | * CAS : 344-25-2 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971012 6971012] |
+ | * HMDB : HMDB03411 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00763 C00763] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57726 57726] | ||
+ | * METABOLIGHTS : MTBLC57726 | ||
+ | {{#set: smiles=C1([N+]C(CC1)C(=O)[O-])}} | ||
+ | {{#set: common name=D-proline}} | ||
+ | {{#set: inchi key=InChIKey=ONIBWKKTOPOVIA-SCSAIBSYSA-N}} | ||
+ | {{#set: molecular weight=115.132 }} | ||
+ | {{#set: reversible reaction associated=PROLINE-RACEMASE-RXN}} |
Revision as of 15:53, 21 March 2018
Contents
Metabolite D-PROLINE
- smiles:
- C1([N+]C(CC1)C(=O)[O-])
- common name:
- D-proline
- inchi key:
- InChIKey=ONIBWKKTOPOVIA-SCSAIBSYSA-N
- molecular weight:
- 115.132
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 344-25-2
- PUBCHEM:
- HMDB : HMDB03411
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57726
"C1([N+]C(CC1)C(=O)[O-])" cannot be used as a page name in this wiki.