Difference between revisions of "KDOTRANS-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == * smiles: ** C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-] * inchi key: ** InChIKey=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BNor BNor] == * direction: ** LEFT-TO-RIGHT * common name: ** butanal:NAD+ oxidoreductase (CoA-acyl...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BNor BNor] ==
−
* smiles:
+
* direction:
−
** C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LJQLQCAXBUHEAZ-UWTATZPHSA-J
+
 
* common name:
 
* common name:
−
** 1,3-bisphospho-D-glycerate
+
** butanal:NAD+ oxidoreductase (CoA-acylating)
−
* molecular weight:
+
−
** 262.006   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-phospho-D-glyceroyl-phosphate
 
−
** 3-phosphoglyceroyl-P
 
−
** P-glyceroyl-P
 
−
** phosphoglyceroyl-P
 
−
** 3-phosphoglyceroyl-phosphate
 
−
** 3-P-glyceroyl-P
 
−
** DPG
 
−
** 13-DPG
 
−
** glycerate 1,3-bisphosphate
 
−
** 3-phosphonato-D-glyceroyl phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[ACPh]]
+
* With identifiers:
−
* [[1.2.1.13-RXN]]
+
** 1.0 [[NAD]][c] '''+''' 1.0 [[CO-A]][c] '''+''' 1.0 [[BUTANAL]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c] '''+''' 1.0 [[BUTYRYL-COA]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 NAD+[c] '''+''' 1.0 coenzyme A[c] '''+''' 1.0 butan-1-al[c] '''=>''' 1.0 H+[c] '''+''' 1.0 NADH[c] '''+''' 1.0 butanoyl-CoA[c]
−
* [[GAPOXNPHOSPHN-RXN]]
+
 
−
* [[PHOSGLYPHOS-RXN]]
+
== Genes associated with this reaction  ==
−
* [[GAPDHSYNEC-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2052]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1981-49-3
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC57604
+
{{#set: common name=butanal:NAD+ oxidoreductase (CoA-acylating)}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_2052}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878409 46878409]
+
{{#set: in pathway=}}
−
* HMDB : HMDB01270
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00236 C00236]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.19698372.html 19698372]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57604 57604]
+
−
* BIGG : 13dpg
+
−
{{#set: smiles=C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LJQLQCAXBUHEAZ-UWTATZPHSA-J}}
+
−
{{#set: common name=1,3-bisphospho-D-glycerate}}
+
−
{{#set: molecular weight=262.006    }}
+
−
{{#set: common name=3-phospho-D-glyceroyl-phosphate|3-phosphoglyceroyl-P|P-glyceroyl-P|phosphoglyceroyl-P|3-phosphoglyceroyl-phosphate|3-P-glyceroyl-P|DPG|13-DPG|glycerate 1,3-bisphosphate|3-phosphonato-D-glyceroyl phosphate}}
+
−
{{#set: consumed by=ACPh|1.2.1.13-RXN}}
+
−
{{#set: reversible reaction associated=GAPOXNPHOSPHN-RXN|PHOSGLYPHOS-RXN|GAPDHSYNEC-RXN}}
+

Revision as of 15:53, 21 March 2018

Reaction BNor

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • butanal:NAD+ oxidoreductase (CoA-acylating)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NAD+[c] + 1.0 coenzyme A[c] + 1.0 butan-1-al[c] => 1.0 H+[c] + 1.0 NADH[c] + 1.0 butanoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=KDOTRANS-RXN&oldid=37142"