Difference between revisions of "Tiso gene 1559"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-163 RXN66-163] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-163 RXN66-163] ==
* smiles:
+
* direction:
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L
+
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
* common name:
+
** β-D-ribose 5-phosphate
+
* molecular weight:
+
** 228.095   
+
 
* Synonym(s):
 
* Synonym(s):
** β-D-ribofuranose 5-phosphate
 
** 5-O-phosphono-β-D-ribofuranose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-15346]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-2742]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-2751]][c]
* [[RXN-15345]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 cotinine[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 oxygen[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 H2O[c] '''+''' 1 5'-hydroxycotinine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1035]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY66-221]], nicotine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-221 PWY66-221]
 +
** '''5''' reactions found over '''18''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140377 7140377]
+
{{#set: ec number=EC-1.14.14.1}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_1035}}
** [http://www.chemspider.com/Chemical-Structure.394672.html 394672]
+
{{#set: in pathway=PWY66-221}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235722 1235722]
+
{{#set: reconstruction source=orthology-esiliculosus}}
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L}}
+
{{#set: common name=β-D-ribose 5-phosphate}}
+
{{#set: molecular weight=228.095    }}
+
{{#set: common name=β-D-ribofuranose 5-phosphate|5-O-phosphono-β-D-ribofuranose}}
+
{{#set: consumed by=RXN-15346}}
+
{{#set: produced by=RXN-15345}}
+

Revision as of 16:54, 21 March 2018

Reaction RXN66-163

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-221, nicotine degradation V: PWY66-221
    • 5 reactions found over 18 reactions in the full pathway

Reconstruction information

External links