Difference between revisions of "Tiso gene 1559"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-163 RXN66-163] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-163 RXN66-163] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-2742]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-2751]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 cotinine[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 oxygen[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 H2O[c] '''+''' 1 5'-hydroxycotinine[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_1035]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY66-221]], nicotine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-221 PWY66-221] | ||
+ | ** '''5''' reactions found over '''18''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.14.14.1}} | |
− | + | {{#set: gene associated=Tiso_gene_1035}} | |
− | + | {{#set: in pathway=PWY66-221}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:54, 21 March 2018
Contents
Reaction RXN66-163
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-2742[c] + 1 Red-NADPH-Hemoprotein-Reductases[c] + 1 OXYGEN-MOLECULE[c] => 1 Ox-NADPH-Hemoprotein-Reductases[c] + 1 WATER[c] + 1 CPD-2751[c]
- With common name(s):
- 1 cotinine[c] + 1 a reduced [NADPH-hemoprotein reductase][c] + 1 oxygen[c] => 1 an oxidized [NADPH-hemoprotein reductase][c] + 1 H2O[c] + 1 5'-hydroxycotinine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_1035
- Source: orthology-esiliculosus
Pathways
- PWY66-221, nicotine degradation V: PWY66-221
- 5 reactions found over 18 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus