Difference between revisions of "Tiso gene 12200"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7247 CPD-7247] == * smiles: ** CC(C=CC1(C(CCCC=1C)(C)C))=CC=CC(CCO)C * inchi key: ** InChIK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10955 RXN-10955] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10955 RXN-10955] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/3.1.3 EC-3.1.3] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[1 | + | ** 1 [[CPD-1107]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-178]][c] '''+''' 1 [[Pi]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 D-myo-inositol 1,3,4,5,6-pentakisphosphate[c] '''+''' 1 H2O[c] '''=>''' 1 D-myo-inositol (3,4,5,6)-tetrakisphosphate[c] '''+''' 1 phosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-6365]], D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6365 PWY-6365] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-3.1.3}} | |
− | + | {{#set: in pathway=PWY-6365}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:54, 21 March 2018
Contents
Reaction RXN-10955
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 D-myo-inositol 1,3,4,5,6-pentakisphosphate[c] + 1 H2O[c] => 1 D-myo-inositol (3,4,5,6)-tetrakisphosphate[c] + 1 phosphate[c]
Genes associated with this reaction
Pathways
- PWY-6365, D-myo-inositol (3,4,5,6)-tetrakisphosphate biosynthesis: PWY-6365
- 4 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation