Difference between revisions of "Tiso gene 1600"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == * smiles: ** C([O-])(=O)C=CC([O-])=O * inchi key: ** InChIKey=VZCYOOQTPOCHF...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10919 RXN-10919] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10919 RXN-10919] ==
−
* smiles:
+
* direction:
−
** C([O-])(=O)C=CC([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
+
** [http://enzyme.expasy.org/EC/6.2.1.12 EC-6.2.1.12]
−
* common name:
+
−
** maleate
+
−
* molecular weight:
+
−
** 114.057   
+
 
* Synonym(s):
 
* Synonym(s):
−
** maleic acid
 
−
** cis-butenedioic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-646]]
+
** 1 [[SINAPATE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[SINAPOYL-COA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 sinapate[c] '''+''' 1 ATP[c] '''+''' 1 coenzyme A[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 sinapoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14183]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_12275]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 110-16-7
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R02221 R02221]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288227 5288227]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB00176
+
{{#set: ec number=EC-6.2.1.12}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_14183|Tiso_gene_12275}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01384 C01384]
+
{{#set: in pathway=}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.chemspider.com/Chemical-Structure.4450430.html 4450430]
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30780 30780]
+
−
{{#set: smiles=C([O-])(=O)C=CC([O-])=O}}
+
−
{{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L}}
+
−
{{#set: common name=maleate}}
+
−
{{#set: molecular weight=114.057    }}
+
−
{{#set: common name=maleic acid|cis-butenedioic acid}}
+
−
{{#set: produced by=RXN-646}}
+

Revision as of 16:54, 21 March 2018

Reaction RXN-10919

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 sinapate[c] + 1 ATP[c] + 1 coenzyme A[c] => 1 AMP[c] + 1 diphosphate[c] + 1 sinapoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1600&oldid=37244"