Difference between revisions of "Tiso gene 2786"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] == * smiles: ** CSCCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=MJGXIOUQXYX...")
(Created page with "Category:Gene == Gene Tiso_gene_4894 == * right end position: ** 19613 * transcription direction: ** POSITIVE * left end position: ** 18311 * centisome position: ** 84.624...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] ==
+
== Gene Tiso_gene_4894 ==
−
* smiles:
+
* right end position:
−
** CSCCCCCCCC(=O)C([O-])=O
+
** 19613
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 9-(methylthio)-2-oxononanoate
+
** 18311
−
* molecular weight:
+
* centisome position:
−
** 217.302    
+
** 84.624275    
 
* Synonym(s):
 
* Synonym(s):
−
** 9-(methylthio)-2-oxononanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
−
* [[RXN-18203]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXNQT-4174]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6692]]
 +
* [[PWY-3781]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1334]]
 +
* [[PWY0-1335]]
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=19613}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237169 44237169]
+
{{#set: transcription direction=POSITIVE}}
−
* KNAPSACK : C00007654
+
{{#set: left end position=18311}}
−
{{#set: smiles=CSCCCCCCCC(=O)C([O-])=O}}
+
{{#set: centisome position=84.624275   }}
−
{{#set: inchi key=InChIKey=MJGXIOUQXYXGLP-UHFFFAOYSA-M}}
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN}}
−
{{#set: common name=9-(methylthio)-2-oxononanoate}}
+
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-4302}}
−
{{#set: molecular weight=217.302   }}
+
−
{{#set: common name=9-(methylthio)-2-oxononanoic acid}}
+
−
{{#set: produced by=RXN-18203|RXNQT-4174}}
+

Revision as of 15:54, 21 March 2018

Gene Tiso_gene_4894

  • right end position:
    • 19613
  • transcription direction:
    • POSITIVE
  • left end position:
    • 18311
  • centisome position:
    • 84.624275
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2786&oldid=37280"