Difference between revisions of "Tiso gene 11850"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Tiso_gene_9303 == * right end position: ** 1739 * transcription direction: ** NEGATIVE * left end position: ** 137 * centisome position: ** 1.4512712...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9303 == |
− | * | + | * right end position: |
− | ** | + | ** 1739 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 137 |
− | * | + | * centisome position: |
− | ** | + | ** 1.4512712 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ASPARAGINE--TRNA-LIGASE-RXN]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
− | * | + | * [[TRNA-CHARGING-PWY]] |
− | * | + | |
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=1739}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=137}} | |
− | + | {{#set: centisome position=1.4512712 }} | |
− | + | {{#set: reaction associated=ASPARAGINE--TRNA-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=TRNA-CHARGING-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 15:55, 21 March 2018
Gene Tiso_gene_9303
- right end position:
- 1739
- transcription direction:
- NEGATIVE
- left end position:
- 137
- centisome position:
- 1.4512712
- Synonym(s):
Reactions associated
- Reaction: ASPARAGINE--TRNA-LIGASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation