Difference between revisions of "Tiso gene 4976"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] == * direction: ** REVERSIBLE * common name: ** galactose-3-o-sulfotransferase...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** galactose-3-o-sulfotransferase_2-like |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.8.2.11 EC-2.8.2.11] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[PAPS]][c] '''+''' 1 [[1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol]][c] '''<=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[Seminolipids]][c] '''+''' 1 [[PROTON]][c] | |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 a 1-O-alkyl-2-O-acyl-3-O-β-D-galactosyl-sn-glycerol[c] '''<=>''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 a seminolipid[c] '''+''' 1 H+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_13030]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=galactose-3-o-sulfotransferase_2-like}} | |
| − | + | {{#set: ec number=EC-2.8.2.11}} | |
| − | + | {{#set: gene associated=Tiso_gene_13030}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:55, 21 March 2018
Contents
Reaction RXN-17203
- direction:
- REVERSIBLE
- common name:
- galactose-3-o-sulfotransferase_2-like
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PAPS[c] + 1 1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol[c] <=> 1 3-5-ADP[c] + 1 Seminolipids[c] + 1 PROTON[c]
- With common name(s):
- 1 3'-phosphoadenylyl-sulfate[c] + 1 a 1-O-alkyl-2-O-acyl-3-O-β-D-galactosyl-sn-glycerol[c] <=> 1 adenosine 3',5'-bisphosphate[c] + 1 a seminolipid[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13030
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
