Difference between revisions of "AKGCITtm"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE ALPHA-RIBAZOLE] == * smiles: ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3))) *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10708 RXN-10708] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_thioesteras...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE ALPHA-RIBAZOLE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10708 RXN-10708] ==
−
* smiles:
+
* direction:
−
** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HLRUKOJSWOKCPP-SYQHCUMBSA-N
+
 
* common name:
 
* common name:
−
** α-ribazole
+
** acyl-coenzyme_a_thioesterase_mitochondrial-like
−
* molecular weight:
+
** thioesterase_superfamily_member_2
−
** 278.307   
+
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.2.20 EC-3.1.2.20]
 
* Synonym(s):
 
* Synonym(s):
−
** N1-(α-D-ribosyl)-5,6-dimethylbenzimidazole
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RIBAZOLEPHOSPHAT-RXN]]
+
** 1 [[CPD-11529]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-731]][c]
−
* [[R04594]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 jasmonoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 coenzyme A[c] '''+''' 1 (+)-7-iso-jasmonate[c]
−
* [[COBALAMINSYN-RXN]]
+
 
−
* [[RXN-16788]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10984]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_801]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_7477]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_800]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
 +
** '''15''' reactions found over '''19''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=160433 160433]
+
{{#set: common name=acyl-coenzyme_a_thioesterase_mitochondrial-like}}
−
* HMDB : HMDB11112
+
{{#set: common name=thioesterase_superfamily_member_2}}
−
* LIGAND-CPD:
+
{{#set: common name=ORF}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05775 C05775]
+
{{#set: ec number=EC-3.1.2.20}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_10984|Tiso_gene_801|Tiso_gene_7477|Tiso_gene_800}}
−
** [http://www.chemspider.com/Chemical-Structure.389646.html 389646]
+
{{#set: in pathway=PWY-735}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10329 10329]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
* BIGG : rdmbzi
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3)))}}
+
−
{{#set: inchi key=InChIKey=HLRUKOJSWOKCPP-SYQHCUMBSA-N}}
+
−
{{#set: common name=α-ribazole}}
+
−
{{#set: molecular weight=278.307    }}
+
−
{{#set: common name=N1-(α-D-ribosyl)-5,6-dimethylbenzimidazole}}
+
−
{{#set: produced by=RIBAZOLEPHOSPHAT-RXN|R04594}}
+
−
{{#set: reversible reaction associated=COBALAMINSYN-RXN|RXN-16788}}
+

Revision as of 16:55, 21 March 2018

Reaction RXN-10708

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_thioesterase_mitochondrial-like
    • thioesterase_superfamily_member_2
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 jasmonoyl-CoA[c] + 1 H2O[c] => 1 H+[c] + 1 coenzyme A[c] + 1 (+)-7-iso-jasmonate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-735, jasmonic acid biosynthesis: PWY-735
    • 15 reactions found over 19 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=AKGCITtm&oldid=37379"