Difference between revisions of "Tiso gene 19413"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACDHi ACDHi] == * direction: ** LEFT-TO-RIGHT * common name: ** acetaldehyde-CoA dehydrogenase * Sy...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACDHi ACDHi] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
+
 
* common name:
 
* common name:
−
** campest-4-en-3-one
+
** acetaldehyde-CoA dehydrogenase
−
* molecular weight:
+
−
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
−
** methylcholestenone
 
−
** (24R)-24-methyl-cholest-4-en-3-one
 
−
** 3-dehydro-Δ4-5-campesterol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-711]]
+
* With identifiers:
−
* [[RXN-4231]]
+
** 2.0 [[NADH]][c] '''+''' 2.0 [[PROTON]][c] '''+''' 1.0 [[ACETYL-COA]][c] '''=>''' 1.0 [[ETOH]][c] '''+''' 2.0 [[NAD]][c] '''+''' 1.0 [[CO-A]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 2.0 NADH[c] '''+''' 2.0 H+[c] '''+''' 1.0 acetyl-CoA[c] '''=>''' 1.0 ethanol[c] '''+''' 2.0 NAD+[c] '''+''' 1.0 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2052]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11988279 11988279]
+
{{#set: common name=acetaldehyde-CoA dehydrogenase}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_2052}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
+
{{#set: in pathway=}}
−
* HMDB : HMDB12196
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=campest-4-en-3-one}}
+
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}}
+
−
{{#set: consumed by=RXN-711|RXN-4231}}
+

Revision as of 16:55, 21 March 2018

Reaction ACDHi

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acetaldehyde-CoA dehydrogenase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2.0 NADH[c] + 2.0 H+[c] + 1.0 acetyl-CoA[c] => 1.0 ethanol[c] + 2.0 NAD+[c] + 1.0 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19413&oldid=37389"