Difference between revisions of "2-AMINOADIPATE-AMINOTRANSFERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-L-KYNURENINE 3-HYDROXY-L-KYNURENINE] == * smiles: ** C([O-])(=O)C([N+])CC(=O)C1(=C(N)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pre-tRNA-5-prime-half-molecules Pre-tRNA-5-prime-half-molecules] == * common name: ** a 5'-half...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-L-KYNURENINE 3-HYDROXY-L-KYNURENINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pre-tRNA-5-prime-half-molecules Pre-tRNA-5-prime-half-molecules] ==
* smiles:
+
** C([O-])(=O)C([N+])CC(=O)C1(=C(N)C(O)=CC=C1)
+
* inchi key:
+
** InChIKey=VCKPUUFAIGNJHC-LURJTMIESA-N
+
 
* common name:
 
* common name:
** 3-hydroxy-L-kynurenine
+
** a 5'-half-tRNA molecule with a 2',3'-cyclic phosphate end
* molecular weight:
+
** 224.216   
+
 
* Synonym(s):
 
* Synonym(s):
** L-3-hydroxykynurenine
 
** 3-hydroxy-kynurenine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-HYDROXY-KYNURENINASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
+
* [[3.1.27.9-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-10721]]
 
 
== External links  ==
 
== External links  ==
* CAS : 606-14-4
+
{{#set: common name=a 5'-half-tRNA molecule with a 2',3'-cyclic phosphate end}}
* PUBCHEM:
+
{{#set: produced by=3.1.27.9-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791998 49791998]
+
* HMDB : HMDB11631
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02794 C02794]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58125 58125]
+
* METABOLIGHTS : MTBLC58125
+
{{#set: smiles=C([O-])(=O)C([N+])CC(=O)C1(=C(N)C(O)=CC=C1)}}
+
{{#set: inchi key=InChIKey=VCKPUUFAIGNJHC-LURJTMIESA-N}}
+
{{#set: common name=3-hydroxy-L-kynurenine}}
+
{{#set: molecular weight=224.216    }}
+
{{#set: common name=L-3-hydroxykynurenine|3-hydroxy-kynurenine}}
+
{{#set: consumed by=3-HYDROXY-KYNURENINASE-RXN}}
+
{{#set: produced by=KYNURENINE-3-MONOOXYGENASE-RXN}}
+
{{#set: reversible reaction associated=RXN-10721}}
+

Revision as of 15:56, 21 March 2018

Metabolite Pre-tRNA-5-prime-half-molecules

  • common name:
    • a 5'-half-tRNA molecule with a 2',3'-cyclic phosphate end
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links