Difference between revisions of "Beta-D-glucan-w-C-3-substitution"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17790 RXN-17790] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-_dehydrogenas...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17790 RXN-17790] ==
* smiles:
+
* direction:
** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** delphinidin
+
** 3-hydroxyacyl-_dehydrogenase
* molecular weight:
+
** hydroxyacyl-coenzyme_a_mitochondrial
** 301.232   
+
** hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
 
* Synonym(s):
 
* Synonym(s):
** delfinidin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-9723]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPD-19155]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-19158]][c] '''+''' 1 [[NADH]][c]
* [[RXN-7785]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA[c] '''=>''' 1 H+[c] '''+''' 1 3-oxo-(9Z)-hexadecenoyl-CoA[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18838]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18839]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5857]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14262]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14026]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203213 25203213]
+
{{#set: common name=3-hydroxyacyl-_dehydrogenase}}
* CHEBI:
+
{{#set: common name=hydroxyacyl-coenzyme_a_mitochondrial}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28436 28436]
+
{{#set: common name=hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit}}
* LIGAND-CPD:
+
{{#set: ec number=EC-1.1.1.35}}
** [http://www.genome.jp/dbget-bin/www_bget?C05908 C05908]
+
{{#set: gene associated=Tiso_gene_18838|Tiso_gene_18839|Tiso_gene_5857|Tiso_gene_14262|Tiso_gene_14026}}
* HMDB : HMDB03074
+
{{#set: in pathway=}}
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
{{#set: common name=delphinidin}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: molecular weight=301.232    }}
+
{{#set: common name=delfinidin}}
+
{{#set: consumed by=RXN-9723}}
+
{{#set: produced by=RXN-7785}}
+

Revision as of 15:56, 21 March 2018

Reaction RXN-17790

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxyacyl-_dehydrogenase
    • hydroxyacyl-coenzyme_a_mitochondrial
    • hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA[c] => 1 H+[c] + 1 3-oxo-(9Z)-hexadecenoyl-CoA[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links