Difference between revisions of "3.2.1.73-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14283 CPD-14283] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)CO...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 572.278 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** iPTP |
− | ** | + | ** isopentenyladenosine riboside-5'-triphosphate |
+ | ** iPRTP | ||
+ | ** isopentenyladenosine-5'-triphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-4303]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203647 25203647] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71679 71679] |
− | {{#set: smiles | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16424 C16424] |
− | {{#set: | + | {{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C}} |
− | {{#set: molecular weight= | + | {{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K}} |
− | + | {{#set: molecular weight=572.278 }} | |
− | {{#set: produced by=RXN- | + | {{#set: common name=iPTP|isopentenyladenosine riboside-5'-triphosphate|iPRTP|isopentenyladenosine-5'-triphosphate}} |
+ | {{#set: produced by=RXN-4303}} |
Revision as of 16:56, 21 March 2018
Contents
Metabolite CPD-4201
- smiles:
- CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
- common name:
- N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
- inchi key:
- InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
- molecular weight:
- 572.278
- Synonym(s):
- iPTP
- isopentenyladenosine riboside-5'-triphosphate
- iPRTP
- isopentenyladenosine-5'-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C" cannot be used as a page name in this wiki.