Difference between revisions of "Double-helix-DNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SEDOHEPTULOSE-1-7-P2 D-SEDOHEPTULOSE-1-7-P2] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12124 RXN-12124] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-5-alpha-steroid_4-deh...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SEDOHEPTULOSE-1-7-P2 D-SEDOHEPTULOSE-1-7-P2] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12124 RXN-12124] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C(O)C(O)C(O)C(O)C(COP([O-])(=O)[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OKHXOUGRECCASI-SHUUEZRQSA-J
+
 
* common name:
 
* common name:
−
** D-sedoheptulose-1,7-bisphosphate
+
** 3-oxo-5-alpha-steroid_4-dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 366.112   
+
** [http://enzyme.expasy.org/EC/1.3.99.5 EC-1.3.99.5]
 
* Synonym(s):
 
* Synonym(s):
−
** sedoheptulose 1,7-bisphosphate
 
−
** D-sedoheptulose-1,7-diphosphate
 
−
** D-sedoheptulose-1,7-P2
 
−
** SBP
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Acceptor]][c] '''+''' 1 [[CPD-342]][c] '''=>''' 1 [[Donor-H2]][c] '''+''' 1 [[ANDROST4ENE]][c]
−
* [[RXN0-6541]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 an oxidized electron acceptor[c] '''+''' 1 5α-androstane-3,17-dione[c] '''=>''' 1 a reduced electron acceptor[c] '''+''' 1 androst-4-ene-3,17-dione[c]
−
* [[SEDOBISALDOL-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14327]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6943]], testosterone and androsterone degradation to androstendione: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6943 PWY-6943]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00447 C00447]
+
{{#set: common name=3-oxo-5-alpha-steroid_4-dehydrogenase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.3.99.5}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58335 58335]
+
{{#set: gene associated=Tiso_gene_14327}}
−
* METABOLIGHTS : MTBLC58335
+
{{#set: in pathway=PWY-6943}}
−
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878435 46878435]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
* HMDB : HMDB60274
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(O)C(O)C(COP([O-])(=O)[O-])=O}}
+
−
{{#set: inchi key=InChIKey=OKHXOUGRECCASI-SHUUEZRQSA-J}}
+
−
{{#set: common name=D-sedoheptulose-1,7-bisphosphate}}
+
−
{{#set: molecular weight=366.112    }}
+
−
{{#set: common name=sedoheptulose 1,7-bisphosphate|D-sedoheptulose-1,7-diphosphate|D-sedoheptulose-1,7-P2|SBP}}
+
−
{{#set: consumed by=SEDOHEPTULOSE-BISPHOSPHATASE-RXN}}
+
−
{{#set: produced by=RXN0-6541}}
+
−
{{#set: reversible reaction associated=SEDOBISALDOL-RXN}}
+

Revision as of 15:56, 21 March 2018

Reaction RXN-12124

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-5-alpha-steroid_4-dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an oxidized electron acceptor[c] + 1 5α-androstane-3,17-dione[c] => 1 a reduced electron acceptor[c] + 1 androst-4-ene-3,17-dione[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6943, testosterone and androsterone degradation to androstendione: PWY-6943
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Double-helix-DNA&oldid=37436"