Difference between revisions of "UDP-MANNAC"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-...")
(Created page with "Category:Gene == Gene Tiso_gene_10543 == * right end position: ** 8416 * transcription direction: ** NEGATIVE * left end position: ** 6659 * centisome position: ** 78.7860...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
+
== Gene Tiso_gene_10543 ==
* smiles:
+
* right end position:
** C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O
+
** 8416
* inchi key:
+
* transcription direction:
** InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J
+
** NEGATIVE
* common name:
+
* left end position:
** 2-hydroxy-dATP
+
** 6659
* molecular weight:
+
* centisome position:
** 503.152    
+
** 78.78609    
 
* Synonym(s):
 
* Synonym(s):
** 2-hydroxy-2'-deoxyadenosine 5'-triphosphate
 
** 2'-deoxyisoguanosine triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
* [[RXN-14290]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=8416}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289402 86289402]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: left end position=6659}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77897 77897]
+
{{#set: centisome position=78.78609   }}
{{#set: smiles=C(C3(C(CC(N2(C1(=C(C(N)=NC(=O)N1)N=C2)))O3)O))OP(OP(OP([O-])(=O)[O-])([O-])=O)([O-])=O}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
{{#set: inchi key=InChIKey=UOACBPRDWRDEHJ-KVQBGUIXSA-J}}
+
{{#set: common name=2-hydroxy-dATP}}
+
{{#set: molecular weight=503.152   }}
+
{{#set: common name=2-hydroxy-2'-deoxyadenosine 5'-triphosphate|2'-deoxyisoguanosine triphosphate}}
+
{{#set: produced by=RXN-14290}}
+

Revision as of 15:56, 21 March 2018

Gene Tiso_gene_10543

  • right end position:
    • 8416
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 6659
  • centisome position:
    • 78.78609
  • Synonym(s):

Reactions associated

Pathways associated

External links