Difference between revisions of "Sulfurylated-ThiI"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * smiles: ** C(C([N+])C(=O)[O-])S([O-])=O * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16557 RXN-16557] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16557 RXN-16557] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** acyl-coenzyme_a_oxidase |
− | * | + | ** acyl-_dehydrogenase |
− | ** | + | ** ORF |
+ | ** acyl-CoA_dehydrogenase | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.3.8.9 EC-1.3.8.9] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[ETF-Oxidized]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-16001]][c] '''=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[CPD-17813]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 H+[c] '''+''' 1 (11Z)-hexadecenoyl-CoA[c] '''=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 (2E,11Z)-hexadec-2,11-dienoyl-CoA[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_17967]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18566]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_883]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_5991]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_16631]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_6475]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7656]], Spodoptera littoralis pheromone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7656 PWY-7656] | ||
+ | ** '''6''' reactions found over '''22''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=acyl-coenzyme_a_oxidase}} | |
− | + | {{#set: common name=acyl-_dehydrogenase}} | |
− | + | {{#set: common name=ORF}} | |
− | + | {{#set: common name=acyl-CoA_dehydrogenase}} | |
− | + | {{#set: ec number=EC-1.3.8.9}} | |
− | + | {{#set: gene associated=Tiso_gene_17967|Tiso_gene_18566|Tiso_gene_883|Tiso_gene_5991|Tiso_gene_16631|Tiso_gene_6475}} | |
− | + | {{#set: in pathway=PWY-7656}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:56, 21 March 2018
Contents
Reaction RXN-16557
- direction:
- LEFT-TO-RIGHT
- common name:
- acyl-coenzyme_a_oxidase
- acyl-_dehydrogenase
- ORF
- acyl-CoA_dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ETF-Oxidized[c] + 1 PROTON[c] + 1 CPD-16001[c] => 1 ETF-Reduced[c] + 1 CPD-17813[c]
- With common name(s):
- 1 an oxidized electron-transfer flavoprotein[c] + 1 H+[c] + 1 (11Z)-hexadecenoyl-CoA[c] => 1 a reduced electron-transfer flavoprotein[c] + 1 (2E,11Z)-hexadec-2,11-dienoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_17967
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18566
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_883
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_5991
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16631
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_6475
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7656, Spodoptera littoralis pheromone biosynthesis: PWY-7656
- 6 reactions found over 22 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation