Difference between revisions of "ILE-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_44 == * right end position: ** 19959 * transcription direction: ** POSITIVE * left end position: ** 11667 * centisome position: ** 23.77575...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_44 == |
− | * | + | * right end position: |
− | ** | + | ** 19959 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 11667 |
− | * | + | * centisome position: |
− | ** | + | ** 23.775753 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=19959}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=11667}} | |
− | + | {{#set: centisome position=23.775753 }} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:56, 21 March 2018
Gene Tiso_gene_44
- right end position:
- 19959
- transcription direction:
- POSITIVE
- left end position:
- 11667
- centisome position:
- 23.775753
- Synonym(s):
Reactions associated
- Reaction: DNA-DIRECTED-RNA-POLYMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation