Difference between revisions of "CPD0-1812"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_14707 == * Synonym(s): == Reactions associated == * Reaction: 1.14.11.18-RXN ** Source: orthology-esiliculosus * Reaction: RXN66...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14707 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.14.11.18-RXN]] | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN66-470]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY66-387]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=1.14.11.18-RXN|RXN66-470}} | |
− | + | {{#set: pathway associated=PWY66-387}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 16:57, 21 March 2018
Gene Tiso_gene_14707
- Synonym(s):
Reactions associated
- Reaction: 1.14.11.18-RXN
- Source: orthology-esiliculosus
- Reaction: RXN66-470
- Source: orthology-esiliculosus