Difference between revisions of "ALLO-THR"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KDO-8P KDO-8P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)[CH]1(OC(O)(C([O-])=O)CC(C1O)O) * inchi k...") |
(Created page with "Category:Gene == Gene Tiso_gene_15594 == * Synonym(s): == Reactions associated == * Reaction: 1.14.11.2-RXN ** Source: orthology-esiliculosus * Reaction: RXN490...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_15594 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[1.14.11.2-RXN]] | |
| − | * [[ | + | ** Source: [[orthology-esiliculosus]] |
| − | == | + | * Reaction: [[RXN490-3641]] |
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 16:57, 21 March 2018
Gene Tiso_gene_15594
- Synonym(s):
Reactions associated
- Reaction: 1.14.11.2-RXN
- Source: orthology-esiliculosus
- Reaction: RXN490-3641
- Source: orthology-esiliculosus
