Difference between revisions of "RXN-14726"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] == * smiles: ** CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Gene == Gene Tiso_gene_6004 == * right end position: ** 12670 * transcription direction: ** POSITIVE * left end position: ** 11397 * centisome position: ** 60.966...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] ==
+
== Gene Tiso_gene_6004 ==
* smiles:
+
* right end position:
** CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 12670
* inchi key:
+
* transcription direction:
** InChIKey=RCVJZGBRLGUTKT-CGGPSVLLSA-J
+
** POSITIVE
* common name:
+
* left end position:
** (5Z)-dodecenoyl-CoA
+
** 11397
* molecular weight:
+
* centisome position:
** 943.792    
+
** 60.966087    
 
* Synonym(s):
 
* Synonym(s):
** 12:1-Δ5-CoA
 
** cis-5-tetradecenoyl-CoA
 
** 12:1(n-7)-CoA
 
** (5Z)-tetradec-5-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17796]]
+
* Reaction: [[METHYLENETHFDEHYDROG-NADP-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-17795]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-1722]]
 +
* [[PWY-3841]]
 +
* [[1CMET2-PWY]]
 +
* [[CODH-PWY]]
 +
* [[PWY-5497]]
 +
* [[PWY-2201]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=12670}}
{{#set: inchi key=InChIKey=RCVJZGBRLGUTKT-CGGPSVLLSA-J}}
+
{{#set: transcription direction=POSITIVE}}
{{#set: common name=(5Z)-dodecenoyl-CoA}}
+
{{#set: left end position=11397}}
{{#set: molecular weight=943.792   }}
+
{{#set: centisome position=60.966087   }}
{{#set: common name=12:1-Δ5-CoA|cis-5-tetradecenoyl-CoA|12:1(n-7)-CoA|(5Z)-tetradec-5-enoyl-CoA}}
+
{{#set: reaction associated=METHYLENETHFDEHYDROG-NADP-RXN}}
{{#set: consumed by=RXN-17796}}
+
{{#set: pathway associated=PWY-1722|PWY-3841|1CMET2-PWY|CODH-PWY|PWY-5497|PWY-2201}}
{{#set: produced by=RXN-17795}}
+

Revision as of 16:57, 21 March 2018

Gene Tiso_gene_6004

  • right end position:
    • 12670
  • transcription direction:
    • POSITIVE
  • left end position:
    • 11397
  • centisome position:
    • 60.966087
  • Synonym(s):

Reactions associated

Pathways associated

External links