Difference between revisions of "Tiso gene 8614"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TARTRONATE-S-ALD TARTRONATE-S-ALD] == * smiles: ** [CH](=O)C(O)C(=O)[O-] * inchi key: ** InChIK...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketoglutaryl-ACP-methyl-ester 3-Ketoglutaryl-ACP-methyl-ester] == * common name: ** a 3-oxo-g...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TARTRONATE-S-ALD TARTRONATE-S-ALD] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketoglutaryl-ACP-methyl-ester 3-Ketoglutaryl-ACP-methyl-ester] ==
* smiles:
+
** [CH](=O)C(O)C(=O)[O-]
+
* inchi key:
+
** InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** tartronate semialdehyde
+
** a 3-oxo-glutaryl-[acp] methyl ester
* molecular weight:
+
** 103.054   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-hydroxy-3-oxopropanoate
+
** a 3-ketoglutaryl-[acp] methyl ester
** tartronic semialdehyde
+
** a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester
** hydroxymalonaldehydic acid
+
** tartronate-S-ald
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R01747]]
+
* [[RXN-11476]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11474]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN0-5289]]
 
* [[RXN0-305]]
 
* [[4.1.2.20-RXN]]
 
* [[KDGALDOL-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 2480-77-5
+
{{#set: common name=a 3-oxo-glutaryl-[acp] methyl ester}}
* PUBCHEM:
+
{{#set: common name=a 3-ketoglutaryl-[acp] methyl ester|a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22134427 22134427]
+
{{#set: consumed by=RXN-11476}}
* HMDB : HMDB06938
+
{{#set: produced by=RXN-11474}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01146 C01146]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57978 57978]
+
* BIGG : 2h3oppan
+
{{#set: smiles=[CH](=O)C(O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M}}
+
{{#set: common name=tartronate semialdehyde}}
+
{{#set: molecular weight=103.054    }}
+
{{#set: common name=2-hydroxy-3-oxopropanoate|tartronic semialdehyde|hydroxymalonaldehydic acid|tartronate-S-ald}}
+
{{#set: consumed by=R01747}}
+
{{#set: reversible reaction associated=RXN0-5289|RXN0-305|4.1.2.20-RXN|KDGALDOL-RXN}}
+

Revision as of 15:58, 21 March 2018

Metabolite 3-Ketoglutaryl-ACP-methyl-ester

  • common name:
    • a 3-oxo-glutaryl-[acp] methyl ester
  • Synonym(s):
    • a 3-ketoglutaryl-[acp] methyl ester
    • a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-glutaryl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-ketoglutaryl-[acp] methyl ester" cannot be used as a page name in this wiki.
  • "a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester" cannot be used as a page name in this wiki.