Difference between revisions of "RXN-17609"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...") |
(Created page with "Category:Gene == Gene Tiso_gene_12589 == * right end position: ** 2524 * transcription direction: ** POSITIVE * left end position: ** 537 * centisome position: ** 7.840560...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12589 == |
− | * | + | * right end position: |
− | ** | + | ** 2524 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 537 |
− | * | + | * centisome position: |
− | ** | + | ** 7.8405604 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-6359]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[THIOSULFATE-SULFURTRANSFERASE-RXN]] |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
− | + | * [[PWY-5350]] | |
== External links == | == External links == | ||
− | + | {{#set: right end position=2524}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=537}} | |
− | + | {{#set: centisome position=7.8405604 }} | |
− | + | {{#set: reaction associated=RXN0-6359|THIOSULFATE-SULFURTRANSFERASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5350}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 15:58, 21 March 2018
Gene Tiso_gene_12589
- right end position:
- 2524
- transcription direction:
- POSITIVE
- left end position:
- 537
- centisome position:
- 7.8405604
- Synonym(s):
Reactions associated
- Reaction: RXN0-6359
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: THIOSULFATE-SULFURTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation